About N'-(6-tert-butylthieno[3,2-d]pyrimidin-4-yl)-4-methylbenzohydrazide
N'-(6-tert-butylthieno[3,2-d]pyrimidin-4-yl)-4-methylbenzohydrazide (PubChem CID 2809068) has the molecular formula C18H20N4OS
and a molecular weight of 340.45 g/mol. Its IUPAC name is N'-(6-tert-butylthieno[3,2-d]pyrimidin-4-yl)-4-methylbenzohydrazide.
Molecular Properties
| Compound Name | N'-(6-tert-butylthieno[3,2-d]pyrimidin-4-yl)-4-methylbenzohydrazide |
| PubChem CID | 2809068 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N'-(6-tert-butylthieno[3,2-d]pyrimidin-4-yl)-4-methylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)NNc2ncnc3cc(C(C)(C)C)sc23)cc1 |
| InChI | InChI=1S/C18H20N4OS/c1-11-5-7-12(8-6-11)17(23)22-21-16-15-13(19-10-20-16)9-14(24-15)18(2,3)4/h5-10H,1-4H3,(H,22,23)(H,19,20,21) |
| InChIKey | QWNJWSWNAFNPIN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(6-tert-butylthieno[3,2-d]pyrimidin-4-yl)-4-methylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(6-tert-butylthieno[3,2-d]pyrimidin-4-yl)-4-methylbenzohydrazide?
The IUPAC name of N'-(6-tert-butylthieno[3,2-d]pyrimidin-4-yl)-4-methylbenzohydrazide (CID 2809068) is N'-(6-tert-butylthieno[3,2-d]pyrimidin-4-yl)-4-methylbenzohydrazide.
What is the SMILES notation for N'-(6-tert-butylthieno[3,2-d]pyrimidin-4-yl)-4-methylbenzohydrazide?
The canonical SMILES for N'-(6-tert-butylthieno[3,2-d]pyrimidin-4-yl)-4-methylbenzohydrazide is Cc1ccc(C(=O)NNc2ncnc3cc(C(C)(C)C)sc23)cc1.
What is the InChIKey of N'-(6-tert-butylthieno[3,2-d]pyrimidin-4-yl)-4-methylbenzohydrazide?
The InChIKey is QWNJWSWNAFNPIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4OS/c1-11-5-7-12(8-6-11)17(23)22-21-16-15-13(19-10-20-16)9-14(24-15)18(2,3)4/h5-10H,1-4H3,(H,22,23)(H,19,20,21).
What are the key properties of N'-(6-tert-butylthieno[3,2-d]pyrimidin-4-yl)-4-methylbenzohydrazide?
N'-(6-tert-butylthieno[3,2-d]pyrimidin-4-yl)-4-methylbenzohydrazide has a molecular weight of 340.45 g/mol, XLogP of 4.05, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(6-tert-butylthieno[3,2-d]pyrimidin-4-yl)-4-methylbenzohydrazide is sourced from PubChem (CID 2809068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).