C14H11F6N3O — CID 2809603
N-[1-methyl-3-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]pyrazol-5-yl]acetamide (PubChem CID 2809603) has the molecular formula C14H11F6N3O and a molecular weight of 351.25 g/mol. Its IUPAC name is N-[1-methyl-3-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]pyrazol-5-yl]acetamide.
| Compound Name | N-[1-methyl-3-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]pyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 2809603 |
| Molecular Formula | C14H11F6N3O |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-[1-methyl-3-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]pyrazol-5-yl]acetamide |
| SMILES | CC(=O)Nc1c(-c2cccc(C(F)(F)F)c2)c(C(F)(F)F)nn1C |
| InChI | InChI=1S/C14H11F6N3O/c1-7(24)21-12-10(11(14(18,19)20)22-23(12)2)8-4-3-5-9(6-8)13(15,16)17/h3-6H,1-2H3,(H,21,24) |
| InChIKey | NHRUKVYEJWIRGA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |