About methyl 3-(2,2-dimethylpropanoylamino)thiophene-2-carboxylate
methyl 3-(2,2-dimethylpropanoylamino)thiophene-2-carboxylate (PubChem CID 2809683) has the molecular formula C11H15NO3S
and a molecular weight of 241.31 g/mol. Its IUPAC name is methyl 3-(2,2-dimethylpropanoylamino)thiophene-2-carboxylate.
Analyze methyl 3-(2,2-dimethylpropanoylamino)thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2,2-dimethylpropanoylamino)thiophene-2-carboxylate?
The IUPAC name of methyl 3-(2,2-dimethylpropanoylamino)thiophene-2-carboxylate (CID 2809683) is methyl 3-(2,2-dimethylpropanoylamino)thiophene-2-carboxylate.
What is the SMILES notation for methyl 3-(2,2-dimethylpropanoylamino)thiophene-2-carboxylate?
The canonical SMILES for methyl 3-(2,2-dimethylpropanoylamino)thiophene-2-carboxylate is COC(=O)c1sccc1NC(=O)C(C)(C)C.
What is the InChIKey of methyl 3-(2,2-dimethylpropanoylamino)thiophene-2-carboxylate?
The InChIKey is UMECWUPJPGGLTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3S/c1-11(2,3)10(14)12-7-5-6-16-8(7)9(13)15-4/h5-6H,1-4H3,(H,12,14).
What are the key properties of methyl 3-(2,2-dimethylpropanoylamino)thiophene-2-carboxylate?
methyl 3-(2,2-dimethylpropanoylamino)thiophene-2-carboxylate has a molecular weight of 241.31 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,2-dimethylpropanoylamino)thiophene-2-carboxylate is sourced from PubChem (CID 2809683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).