About 2-chloro-3-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)aniline chloride
2-chloro-3-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)aniline chloride (PubChem CID 28098) has the molecular formula C10H13Cl2N3
and a molecular weight of 246.14 g/mol. Its IUPAC name is 2-chloro-3-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)aniline chloride.
Molecular Properties
| Compound Name | 2-chloro-3-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)aniline chloride |
| PubChem CID | 28098 |
| Molecular Formula | C10H13Cl2N3 |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-chloro-3-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)aniline chloride |
| SMILES | Nc1cccc(CC2=NCC[NH2+]2)c1Cl.[Cl-] |
| InChI | InChI=1S/C10H12ClN3.ClH/c11-10-7(2-1-3-8(10)12)6-9-13-4-5-14-9;/h1-3H,4-6,12H2,(H,13,14);1H |
| InChIKey | UVBMLGHVEIOYHO-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 54.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)aniline chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)aniline chloride?
The IUPAC name of 2-chloro-3-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)aniline chloride (CID 28098) is 2-chloro-3-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)aniline chloride.
What is the SMILES notation for 2-chloro-3-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)aniline chloride?
The canonical SMILES for 2-chloro-3-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)aniline chloride is Nc1cccc(CC2=NCC[NH2+]2)c1Cl.[Cl-].
What is the InChIKey of 2-chloro-3-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)aniline chloride?
The InChIKey is UVBMLGHVEIOYHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN3.ClH/c11-10-7(2-1-3-8(10)12)6-9-13-4-5-14-9;/h1-3H,4-6,12H2,(H,13,14);1H.
What are the key properties of 2-chloro-3-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)aniline chloride?
2-chloro-3-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)aniline chloride has a molecular weight of 246.14 g/mol, XLogP of -2.56, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)aniline chloride is sourced from PubChem (CID 28098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).