C27H31FN4O4 — CID 2809860
methyl 5-[[3-tert-butyl-1-[(4-fluorophenyl)methyl]pyrazole-5-carbonyl]amino]-2-morpholin-4-ylbenzoate (PubChem CID 2809860) has the molecular formula C27H31FN4O4 and a molecular weight of 494.57 g/mol. Its IUPAC name is methyl 5-[[3-tert-butyl-1-[(4-fluorophenyl)methyl]pyrazole-5-carbonyl]amino]-2-morpholin-4-ylbenzoate.
| Compound Name | methyl 5-[[3-tert-butyl-1-[(4-fluorophenyl)methyl]pyrazole-5-carbonyl]amino]-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 2809860 |
| Molecular Formula | C27H31FN4O4 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | methyl 5-[[3-tert-butyl-1-[(4-fluorophenyl)methyl]pyrazole-5-carbonyl]amino]-2-morpholin-4-ylbenzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2cc(C(C)(C)C)nn2Cc2ccc(F)cc2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C27H31FN4O4/c1-27(2,3)24-16-23(32(30-24)17-18-5-7-19(28)8-6-18)25(33)29-20-9-10-22(21(15-20)26(34)35-4)31-11-13-36-14-12-31/h5-10,15-16H,11-14,17H2,1-4H3,(H,29,33) |
| InChIKey | IAOJTCOWDUQPLG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|