About 5-(4-fluorophenyl)-3,7-diphenyl-4H-diazepine
5-(4-fluorophenyl)-3,7-diphenyl-4H-diazepine (PubChem CID 2810038) has the molecular formula C23H17FN2
and a molecular weight of 340.40 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3,7-diphenyl-4H-diazepine.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-3,7-diphenyl-4H-diazepine |
| PubChem CID | 2810038 |
| Molecular Formula | C23H17FN2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 5-(4-fluorophenyl)-3,7-diphenyl-4H-diazepine |
| SMILES | Fc1ccc(C2=CC(c3ccccc3)=NN=C(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C23H17FN2/c24-21-13-11-17(12-14-21)20-15-22(18-7-3-1-4-8-18)25-26-23(16-20)19-9-5-2-6-10-19/h1-15H,16H2 |
| InChIKey | RMNBCOIFMDANCA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-fluorophenyl)-3,7-diphenyl-4H-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-3,7-diphenyl-4H-diazepine?
The IUPAC name of 5-(4-fluorophenyl)-3,7-diphenyl-4H-diazepine (CID 2810038) is 5-(4-fluorophenyl)-3,7-diphenyl-4H-diazepine.
What is the SMILES notation for 5-(4-fluorophenyl)-3,7-diphenyl-4H-diazepine?
The canonical SMILES for 5-(4-fluorophenyl)-3,7-diphenyl-4H-diazepine is Fc1ccc(C2=CC(c3ccccc3)=NN=C(c3ccccc3)C2)cc1.
What is the InChIKey of 5-(4-fluorophenyl)-3,7-diphenyl-4H-diazepine?
The InChIKey is RMNBCOIFMDANCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17FN2/c24-21-13-11-17(12-14-21)20-15-22(18-7-3-1-4-8-18)25-26-23(16-20)19-9-5-2-6-10-19/h1-15H,16H2.
What are the key properties of 5-(4-fluorophenyl)-3,7-diphenyl-4H-diazepine?
5-(4-fluorophenyl)-3,7-diphenyl-4H-diazepine has a molecular weight of 340.40 g/mol, XLogP of 5.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-3,7-diphenyl-4H-diazepine is sourced from PubChem (CID 2810038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).