About N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)furan-2-carboxamide
N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)furan-2-carboxamide (PubChem CID 2810064) has the molecular formula C15H12N2O5S
and a molecular weight of 332.34 g/mol. Its IUPAC name is N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)furan-2-carboxamide.
Molecular Properties
| Compound Name | N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)furan-2-carboxamide |
| PubChem CID | 2810064 |
| Molecular Formula | C15H12N2O5S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)furan-2-carboxamide |
| SMILES | COc1cc2nc(NC(=O)c3ccco3)sc(=O)c2cc1OC |
| InChI | InChI=1S/C15H12N2O5S/c1-20-11-6-8-9(7-12(11)21-2)16-15(23-14(8)19)17-13(18)10-4-3-5-22-10/h3-7H,1-2H3,(H,16,17,18) |
| InChIKey | OHNPGTLZUDWTGC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)furan-2-carboxamide?
The IUPAC name of N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)furan-2-carboxamide (CID 2810064) is N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)furan-2-carboxamide.
What is the SMILES notation for N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)furan-2-carboxamide?
The canonical SMILES for N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)furan-2-carboxamide is COc1cc2nc(NC(=O)c3ccco3)sc(=O)c2cc1OC.
What is the InChIKey of N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)furan-2-carboxamide?
The InChIKey is OHNPGTLZUDWTGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O5S/c1-20-11-6-8-9(7-12(11)21-2)16-15(23-14(8)19)17-13(18)10-4-3-5-22-10/h3-7H,1-2H3,(H,16,17,18).
What are the key properties of N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)furan-2-carboxamide?
N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)furan-2-carboxamide has a molecular weight of 332.34 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)furan-2-carboxamide is sourced from PubChem (CID 2810064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).