About 4-chloro-N-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide
4-chloro-N-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide (PubChem CID 2810142) has the molecular formula C13H7ClN2O2S2
and a molecular weight of 322.80 g/mol. Its IUPAC name is 4-chloro-N-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide.
Molecular Properties
| Compound Name | 4-chloro-N-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide |
| PubChem CID | 2810142 |
| Molecular Formula | C13H7ClN2O2S2 |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | 4-chloro-N-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide |
| SMILES | O=C(Nc1nc2ccsc2c(=O)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H7ClN2O2S2/c14-8-3-1-7(2-4-8)11(17)16-13-15-9-5-6-19-10(9)12(18)20-13/h1-6H,(H,15,16,17) |
| InChIKey | HNUSIMPTKLXMBS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-N-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide?
The IUPAC name of 4-chloro-N-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide (CID 2810142) is 4-chloro-N-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide.
What is the SMILES notation for 4-chloro-N-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide?
The canonical SMILES for 4-chloro-N-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide is O=C(Nc1nc2ccsc2c(=O)s1)c1ccc(Cl)cc1.
What is the InChIKey of 4-chloro-N-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide?
The InChIKey is HNUSIMPTKLXMBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7ClN2O2S2/c14-8-3-1-7(2-4-8)11(17)16-13-15-9-5-6-19-10(9)12(18)20-13/h1-6H,(H,15,16,17).
What are the key properties of 4-chloro-N-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide?
4-chloro-N-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide has a molecular weight of 322.80 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(4-oxothieno[3,2-d][1,3]thiazin-2-yl)benzamide is sourced from PubChem (CID 2810142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).