About 4-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide
4-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide (PubChem CID 2810145) has the molecular formula C17H13ClN2O4S
and a molecular weight of 376.82 g/mol. Its IUPAC name is 4-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide.
Molecular Properties
| Compound Name | 4-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide |
| PubChem CID | 2810145 |
| Molecular Formula | C17H13ClN2O4S |
| Molecular Weight | 376.82 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 4-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide |
| SMILES | COc1cc2nc(NC(=O)c3ccc(Cl)cc3)sc(=O)c2cc1OC |
| InChI | InChI=1S/C17H13ClN2O4S/c1-23-13-7-11-12(8-14(13)24-2)19-17(25-16(11)22)20-15(21)9-3-5-10(18)6-4-9/h3-8H,1-2H3,(H,19,20,21) |
| InChIKey | JKKOBMJARKMSHM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.82 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide?
The IUPAC name of 4-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide (CID 2810145) is 4-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide.
What is the SMILES notation for 4-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide?
The canonical SMILES for 4-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide is COc1cc2nc(NC(=O)c3ccc(Cl)cc3)sc(=O)c2cc1OC.
What is the InChIKey of 4-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide?
The InChIKey is JKKOBMJARKMSHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN2O4S/c1-23-13-7-11-12(8-14(13)24-2)19-17(25-16(11)22)20-15(21)9-3-5-10(18)6-4-9/h3-8H,1-2H3,(H,19,20,21).
What are the key properties of 4-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide?
4-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide has a molecular weight of 376.82 g/mol, XLogP of 3.58, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)benzamide is sourced from PubChem (CID 2810145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).