About N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)acetamide
N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)acetamide (PubChem CID 2810228) has the molecular formula C12H12N2O4S
and a molecular weight of 280.31 g/mol. Its IUPAC name is N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)acetamide |
| PubChem CID | 2810228 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)acetamide |
| SMILES | COc1cc2nc(NC(C)=O)sc(=O)c2cc1OC |
| InChI | InChI=1S/C12H12N2O4S/c1-6(15)13-12-14-8-5-10(18-3)9(17-2)4-7(8)11(16)19-12/h4-5H,1-3H3,(H,13,14,15) |
| InChIKey | WLNHTJKUJHRFEO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)acetamide?
The IUPAC name of N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)acetamide (CID 2810228) is N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)acetamide.
What is the SMILES notation for N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)acetamide?
The canonical SMILES for N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)acetamide is COc1cc2nc(NC(C)=O)sc(=O)c2cc1OC.
What is the InChIKey of N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)acetamide?
The InChIKey is WLNHTJKUJHRFEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O4S/c1-6(15)13-12-14-8-5-10(18-3)9(17-2)4-7(8)11(16)19-12/h4-5H,1-3H3,(H,13,14,15).
What are the key properties of N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)acetamide?
N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)acetamide has a molecular weight of 280.31 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)acetamide is sourced from PubChem (CID 2810228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).