About 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]-N-(4-phenoxyphenyl)acetamide
2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]-N-(4-phenoxyphenyl)acetamide (PubChem CID 2810277) has the molecular formula C22H19N3O3
and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]-N-(4-phenoxyphenyl)acetamide.
Molecular Properties
| Compound Name | 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]-N-(4-phenoxyphenyl)acetamide |
| PubChem CID | 2810277 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]-N-(4-phenoxyphenyl)acetamide |
| SMILES | Cc1cc(C)c(C#N)c(OCC(=O)Nc2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C22H19N3O3/c1-15-12-16(2)24-22(20(15)13-23)27-14-21(26)25-17-8-10-19(11-9-17)28-18-6-4-3-5-7-18/h3-12H,14H2,1-2H3,(H,25,26) |
| InChIKey | FEKAFFKYHUIYBJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]-N-(4-phenoxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]-N-(4-phenoxyphenyl)acetamide?
The IUPAC name of 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]-N-(4-phenoxyphenyl)acetamide (CID 2810277) is 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]-N-(4-phenoxyphenyl)acetamide.
What is the SMILES notation for 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]-N-(4-phenoxyphenyl)acetamide?
The canonical SMILES for 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]-N-(4-phenoxyphenyl)acetamide is Cc1cc(C)c(C#N)c(OCC(=O)Nc2ccc(Oc3ccccc3)cc2)n1.
What is the InChIKey of 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]-N-(4-phenoxyphenyl)acetamide?
The InChIKey is FEKAFFKYHUIYBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O3/c1-15-12-16(2)24-22(20(15)13-23)27-14-21(26)25-17-8-10-19(11-9-17)28-18-6-4-3-5-7-18/h3-12H,14H2,1-2H3,(H,25,26).
What are the key properties of 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]-N-(4-phenoxyphenyl)acetamide?
2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]-N-(4-phenoxyphenyl)acetamide has a molecular weight of 373.41 g/mol, XLogP of 4.38, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)oxy]-N-(4-phenoxyphenyl)acetamide is sourced from PubChem (CID 2810277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).