C21H19N3O5S — CID 2810663
N-[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]-4-nitrobenzenesulfonamide (PubChem CID 2810663) has the molecular formula C21H19N3O5S and a molecular weight of 425.47 g/mol. Its IUPAC name is N-[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 2810663 |
| Molecular Formula | C21H19N3O5S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | N-[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]-4-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(Oc2ncccc2NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c2c1CCC2 |
| InChI | InChI=1S/C21H19N3O5S/c1-14-7-12-20(18-5-2-4-17(14)18)29-21-19(6-3-13-22-21)23-30(27,28)16-10-8-15(9-11-16)24(25)26/h3,6-13,23H,2,4-5H2,1H3 |
| InChIKey | CRCONFUGXINWSM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|