C16H22N4O4S2 — CID 2810735
N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-1-methylimidazole-4-sulfonamide (PubChem CID 2810735) has the molecular formula C16H22N4O4S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 2810735 |
| Molecular Formula | C16H22N4O4S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)NCC2CCN(S(=O)(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C16H22N4O4S2/c1-19-12-16(17-13-19)25(21,22)18-11-14-7-9-20(10-8-14)26(23,24)15-5-3-2-4-6-15/h2-6,12-14,18H,7-11H2,1H3 |
| InChIKey | FMWYGKOCYJYHDP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |