C17H15N3S — CID 2810767
N-(2,3-dihydro-1H-inden-2-yl)-3-phenyl-1,2,4-thiadiazol-5-amine (PubChem CID 2810767) has the molecular formula C17H15N3S and a molecular weight of 293.40 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-3-phenyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-3-phenyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 2810767 |
| Molecular Formula | C17H15N3S |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-3-phenyl-1,2,4-thiadiazol-5-amine |
| SMILES | c1ccc(-c2nsc(NC3Cc4ccccc4C3)n2)cc1 |
| InChI | InChI=1S/C17H15N3S/c1-2-6-12(7-3-1)16-19-17(21-20-16)18-15-10-13-8-4-5-9-14(13)11-15/h1-9,15H,10-11H2,(H,18,19,20) |
| InChIKey | QDYFSQAMADWDJR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |