About N-(4-methoxy-1-methylindazol-3-yl)-5-methyl-1,2-oxazole-3-carboxamide
N-(4-methoxy-1-methylindazol-3-yl)-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 2810772) has the molecular formula C14H14N4O3
and a molecular weight of 286.29 g/mol. Its IUPAC name is N-(4-methoxy-1-methylindazol-3-yl)-5-methyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(4-methoxy-1-methylindazol-3-yl)-5-methyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 2810772 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-(4-methoxy-1-methylindazol-3-yl)-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | COc1cccc2c1c(NC(=O)c1cc(C)on1)nn2C |
| InChI | InChI=1S/C14H14N4O3/c1-8-7-9(17-21-8)14(19)15-13-12-10(18(2)16-13)5-4-6-11(12)20-3/h4-7H,1-3H3,(H,15,16,19) |
| InChIKey | GTEAZTRHXKDTBC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(4-methoxy-1-methylindazol-3-yl)-5-methyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methoxy-1-methylindazol-3-yl)-5-methyl-1,2-oxazole-3-carboxamide?
The IUPAC name of N-(4-methoxy-1-methylindazol-3-yl)-5-methyl-1,2-oxazole-3-carboxamide (CID 2810772) is N-(4-methoxy-1-methylindazol-3-yl)-5-methyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-(4-methoxy-1-methylindazol-3-yl)-5-methyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-(4-methoxy-1-methylindazol-3-yl)-5-methyl-1,2-oxazole-3-carboxamide is COc1cccc2c1c(NC(=O)c1cc(C)on1)nn2C.
What is the InChIKey of N-(4-methoxy-1-methylindazol-3-yl)-5-methyl-1,2-oxazole-3-carboxamide?
The InChIKey is GTEAZTRHXKDTBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O3/c1-8-7-9(17-21-8)14(19)15-13-12-10(18(2)16-13)5-4-6-11(12)20-3/h4-7H,1-3H3,(H,15,16,19).
What are the key properties of N-(4-methoxy-1-methylindazol-3-yl)-5-methyl-1,2-oxazole-3-carboxamide?
N-(4-methoxy-1-methylindazol-3-yl)-5-methyl-1,2-oxazole-3-carboxamide has a molecular weight of 286.29 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methoxy-1-methylindazol-3-yl)-5-methyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 2810772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).