About 2-aminopyridin-3-ol
2-aminopyridin-3-ol (PubChem CID 28114) has the molecular formula C5H6N2O
and a molecular weight of 110.12 g/mol. Its IUPAC name is 2-aminopyridin-3-ol.
Molecular Properties
| Compound Name | 2-aminopyridin-3-ol |
| PubChem CID | 28114 |
| Molecular Formula | C5H6N2O |
| Molecular Weight | 110.12 g/mol |
| Exact Mass | 110.05 |
| IUPAC Name | 2-aminopyridin-3-ol |
| SMILES | Nc1ncccc1O |
| InChI | InChI=1S/C5H6N2O/c6-5-4(8)2-1-3-7-5/h1-3,8H,(H2,6,7) |
| InChIKey | BMTSZVZQNMNPCT-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.12 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminopyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopyridin-3-ol?
The IUPAC name of 2-aminopyridin-3-ol (CID 28114) is 2-aminopyridin-3-ol.
What is the SMILES notation for 2-aminopyridin-3-ol?
The canonical SMILES for 2-aminopyridin-3-ol is Nc1ncccc1O.
What is the InChIKey of 2-aminopyridin-3-ol?
The InChIKey is BMTSZVZQNMNPCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O/c6-5-4(8)2-1-3-7-5/h1-3,8H,(H2,6,7).
What are the key properties of 2-aminopyridin-3-ol?
2-aminopyridin-3-ol has a molecular weight of 110.12 g/mol, XLogP of 0.37, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopyridin-3-ol is sourced from PubChem (CID 28114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).