About 3,5-dimethyl-N'-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbohydrazide
3,5-dimethyl-N'-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbohydrazide (PubChem CID 2811457) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is 3,5-dimethyl-N'-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbohydrazide.
Molecular Properties
| Compound Name | 3,5-dimethyl-N'-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbohydrazide |
| PubChem CID | 2811457 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3,5-dimethyl-N'-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbohydrazide |
| SMILES | Cc1noc(C)c1C(=O)NNc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C15H19N3O2/c1-9(2)12-5-7-13(8-6-12)16-17-15(19)14-10(3)18-20-11(14)4/h5-9,16H,1-4H3,(H,17,19) |
| InChIKey | YIBQBDDYCJMCNU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-N'-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-N'-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbohydrazide?
The IUPAC name of 3,5-dimethyl-N'-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbohydrazide (CID 2811457) is 3,5-dimethyl-N'-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbohydrazide.
What is the SMILES notation for 3,5-dimethyl-N'-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbohydrazide?
The canonical SMILES for 3,5-dimethyl-N'-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbohydrazide is Cc1noc(C)c1C(=O)NNc1ccc(C(C)C)cc1.
What is the InChIKey of 3,5-dimethyl-N'-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbohydrazide?
The InChIKey is YIBQBDDYCJMCNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2/c1-9(2)12-5-7-13(8-6-12)16-17-15(19)14-10(3)18-20-11(14)4/h5-9,16H,1-4H3,(H,17,19).
What are the key properties of 3,5-dimethyl-N'-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbohydrazide?
3,5-dimethyl-N'-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbohydrazide has a molecular weight of 273.34 g/mol, XLogP of 3.17, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-N'-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbohydrazide is sourced from PubChem (CID 2811457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).