C20H13F4N3O2S2 — CID 2811555
4-fluoro-N-[4-[5-thiophen-2-yl-3-(trifluoromethyl)pyrazol-1-yl]phenyl]benzenesulfonamide (PubChem CID 2811555) has the molecular formula C20H13F4N3O2S2 and a molecular weight of 467.47 g/mol. Its IUPAC name is 4-fluoro-N-[4-[5-thiophen-2-yl-3-(trifluoromethyl)pyrazol-1-yl]phenyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[4-[5-thiophen-2-yl-3-(trifluoromethyl)pyrazol-1-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2811555 |
| Molecular Formula | C20H13F4N3O2S2 |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | 4-fluoro-N-[4-[5-thiophen-2-yl-3-(trifluoromethyl)pyrazol-1-yl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-n2nc(C(F)(F)F)cc2-c2cccs2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H13F4N3O2S2/c21-13-3-9-16(10-4-13)31(28,29)26-14-5-7-15(8-6-14)27-17(18-2-1-11-30-18)12-19(25-27)20(22,23)24/h1-12,26H |
| InChIKey | JLOGRSGTULPSBZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |