C27H26N2O6 — CID 2811724
methyl 4-[5-[(1,3-dioxoisoindol-2-yl)methyl]furan-2-yl]-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 2811724) has the molecular formula C27H26N2O6 and a molecular weight of 474.51 g/mol. Its IUPAC name is methyl 4-[5-[(1,3-dioxoisoindol-2-yl)methyl]furan-2-yl]-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | methyl 4-[5-[(1,3-dioxoisoindol-2-yl)methyl]furan-2-yl]-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 2811724 |
| Molecular Formula | C27H26N2O6 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | methyl 4-[5-[(1,3-dioxoisoindol-2-yl)methyl]furan-2-yl]-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)CC(C)(C)C2)C1c1ccc(CN2C(=O)c3ccccc3C2=O)o1 |
| InChI | InChI=1S/C27H26N2O6/c1-14-21(26(33)34-4)23(22-18(28-14)11-27(2,3)12-19(22)30)20-10-9-15(35-20)13-29-24(31)16-7-5-6-8-17(16)25(29)32/h5-10,23,28H,11-13H2,1-4H3 |
| InChIKey | ZMYGDIJVGKFNKV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|