About 2-[[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]carbamoyl]benzoic acid
2-[[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]carbamoyl]benzoic acid (PubChem CID 2811898) has the molecular formula C20H14N2O3S2
and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-[[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]carbamoyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]carbamoyl]benzoic acid |
| PubChem CID | 2811898 |
| Molecular Formula | C20H14N2O3S2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 2-[[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]carbamoyl]benzoic acid |
| SMILES | Cc1csc(NC(=O)c2ccccc2C(=O)O)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H14N2O3S2/c1-11-10-26-18(16(11)19-21-14-8-4-5-9-15(14)27-19)22-17(23)12-6-2-3-7-13(12)20(24)25/h2-10H,1H3,(H,22,23)(H,24,25) |
| InChIKey | AHRQAUPUDQWMOE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]carbamoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]carbamoyl]benzoic acid?
The IUPAC name of 2-[[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]carbamoyl]benzoic acid (CID 2811898) is 2-[[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]carbamoyl]benzoic acid.
What is the SMILES notation for 2-[[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]carbamoyl]benzoic acid?
The canonical SMILES for 2-[[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]carbamoyl]benzoic acid is Cc1csc(NC(=O)c2ccccc2C(=O)O)c1-c1nc2ccccc2s1.
What is the InChIKey of 2-[[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]carbamoyl]benzoic acid?
The InChIKey is AHRQAUPUDQWMOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N2O3S2/c1-11-10-26-18(16(11)19-21-14-8-4-5-9-15(14)27-19)22-17(23)12-6-2-3-7-13(12)20(24)25/h2-10H,1H3,(H,22,23)(H,24,25).
What are the key properties of 2-[[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]carbamoyl]benzoic acid?
2-[[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]carbamoyl]benzoic acid has a molecular weight of 394.48 g/mol, XLogP of 5.28, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]carbamoyl]benzoic acid is sourced from PubChem (CID 2811898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).