About N'-(2,4-dimethylphenyl)-1,2-oxazole-5-carbohydrazide
N'-(2,4-dimethylphenyl)-1,2-oxazole-5-carbohydrazide (PubChem CID 2812370) has the molecular formula C12H13N3O2
and a molecular weight of 231.25 g/mol. Its IUPAC name is N'-(2,4-dimethylphenyl)-1,2-oxazole-5-carbohydrazide.
Molecular Properties
| Compound Name | N'-(2,4-dimethylphenyl)-1,2-oxazole-5-carbohydrazide |
| PubChem CID | 2812370 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | N'-(2,4-dimethylphenyl)-1,2-oxazole-5-carbohydrazide |
| SMILES | Cc1ccc(NNC(=O)c2ccno2)c(C)c1 |
| InChI | InChI=1S/C12H13N3O2/c1-8-3-4-10(9(2)7-8)14-15-12(16)11-5-6-13-17-11/h3-7,14H,1-2H3,(H,15,16) |
| InChIKey | YGUYDNHVANJKQC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,4-dimethylphenyl)-1,2-oxazole-5-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,4-dimethylphenyl)-1,2-oxazole-5-carbohydrazide?
The IUPAC name of N'-(2,4-dimethylphenyl)-1,2-oxazole-5-carbohydrazide (CID 2812370) is N'-(2,4-dimethylphenyl)-1,2-oxazole-5-carbohydrazide.
What is the SMILES notation for N'-(2,4-dimethylphenyl)-1,2-oxazole-5-carbohydrazide?
The canonical SMILES for N'-(2,4-dimethylphenyl)-1,2-oxazole-5-carbohydrazide is Cc1ccc(NNC(=O)c2ccno2)c(C)c1.
What is the InChIKey of N'-(2,4-dimethylphenyl)-1,2-oxazole-5-carbohydrazide?
The InChIKey is YGUYDNHVANJKQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2/c1-8-3-4-10(9(2)7-8)14-15-12(16)11-5-6-13-17-11/h3-7,14H,1-2H3,(H,15,16).
What are the key properties of N'-(2,4-dimethylphenyl)-1,2-oxazole-5-carbohydrazide?
N'-(2,4-dimethylphenyl)-1,2-oxazole-5-carbohydrazide has a molecular weight of 231.25 g/mol, XLogP of 2.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,4-dimethylphenyl)-1,2-oxazole-5-carbohydrazide is sourced from PubChem (CID 2812370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).