C15H16N2O2 — CID 2812542
2-(anilinomethyl)-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 2812542) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-(anilinomethyl)-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-(anilinomethyl)-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 2812542 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-(anilinomethyl)-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2=C(CCCC2)C(=O)N1CNc1ccccc1 |
| InChI | InChI=1S/C15H16N2O2/c18-14-12-8-4-5-9-13(12)15(19)17(14)10-16-11-6-2-1-3-7-11/h1-3,6-7,16H,4-5,8-10H2 |
| InChIKey | MWVRYWBFQRZLCD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|