About N-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-(trifluoromethyl)benzamide
N-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-(trifluoromethyl)benzamide (PubChem CID 2812628) has the molecular formula C19H19F3N2O3S
and a molecular weight of 412.43 g/mol. Its IUPAC name is N-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | N-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-(trifluoromethyl)benzamide |
| PubChem CID | 2812628 |
| Molecular Formula | C19H19F3N2O3S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc(CN2CCS(=O)(=O)CC2)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19F3N2O3S/c20-19(21,22)16-5-3-15(4-6-16)18(25)23-17-7-1-14(2-8-17)13-24-9-11-28(26,27)12-10-24/h1-8H,9-13H2,(H,23,25) |
| InChIKey | RGKUAPAYMGHOJT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-(trifluoromethyl)benzamide?
The IUPAC name of N-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-(trifluoromethyl)benzamide (CID 2812628) is N-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-(trifluoromethyl)benzamide.
What is the SMILES notation for N-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-(trifluoromethyl)benzamide?
The canonical SMILES for N-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-(trifluoromethyl)benzamide is O=C(Nc1ccc(CN2CCS(=O)(=O)CC2)cc1)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of N-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-(trifluoromethyl)benzamide?
The InChIKey is RGKUAPAYMGHOJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19F3N2O3S/c20-19(21,22)16-5-3-15(4-6-16)18(25)23-17-7-1-14(2-8-17)13-24-9-11-28(26,27)12-10-24/h1-8H,9-13H2,(H,23,25).
What are the key properties of N-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-(trifluoromethyl)benzamide?
N-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-(trifluoromethyl)benzamide has a molecular weight of 412.43 g/mol, XLogP of 3.19, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-(trifluoromethyl)benzamide is sourced from PubChem (CID 2812628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).