C19H20N2O2 — CID 2812716
1-benzyl-3-(3,5-dimethylphenyl)-1,3-diazinane-2,4-dione (PubChem CID 2812716) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-benzyl-3-(3,5-dimethylphenyl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-benzyl-3-(3,5-dimethylphenyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 2812716 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1-benzyl-3-(3,5-dimethylphenyl)-1,3-diazinane-2,4-dione |
| SMILES | Cc1cc(C)cc(N2C(=O)CCN(Cc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C19H20N2O2/c1-14-10-15(2)12-17(11-14)21-18(22)8-9-20(19(21)23)13-16-6-4-3-5-7-16/h3-7,10-12H,8-9,13H2,1-2H3 |
| InChIKey | BSVGNYMXCQGYAI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |