About methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoate
methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoate (PubChem CID 2812754) has the molecular formula C13H14N2O5S
and a molecular weight of 310.33 g/mol. Its IUPAC name is methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoate.
Molecular Properties
| Compound Name | methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoate |
| PubChem CID | 2812754 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NS(=O)(=O)c1c(C)noc1C |
| InChI | InChI=1S/C13H14N2O5S/c1-8-12(9(2)20-14-8)21(17,18)15-11-7-5-4-6-10(11)13(16)19-3/h4-7,15H,1-3H3 |
| InChIKey | PVNUALWPLLUROR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoate?
The IUPAC name of methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoate (CID 2812754) is methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoate.
What is the SMILES notation for methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoate?
The canonical SMILES for methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoate is COC(=O)c1ccccc1NS(=O)(=O)c1c(C)noc1C.
What is the InChIKey of methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoate?
The InChIKey is PVNUALWPLLUROR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O5S/c1-8-12(9(2)20-14-8)21(17,18)15-11-7-5-4-6-10(11)13(16)19-3/h4-7,15H,1-3H3.
What are the key properties of methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoate?
methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoate has a molecular weight of 310.33 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoate is sourced from PubChem (CID 2812754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).