About 7-fluoro-1,2,3,4-tetrahydrophenazine
7-fluoro-1,2,3,4-tetrahydrophenazine (PubChem CID 2812780) has the molecular formula C12H11FN2
and a molecular weight of 202.23 g/mol. Its IUPAC name is 7-fluoro-1,2,3,4-tetrahydrophenazine.
Molecular Properties
| Compound Name | 7-fluoro-1,2,3,4-tetrahydrophenazine |
| PubChem CID | 2812780 |
| Molecular Formula | C12H11FN2 |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 7-fluoro-1,2,3,4-tetrahydrophenazine |
| SMILES | Fc1ccc2nc3c(nc2c1)CCCC3 |
| InChI | InChI=1S/C12H11FN2/c13-8-5-6-11-12(7-8)15-10-4-2-1-3-9(10)14-11/h5-7H,1-4H2 |
| InChIKey | LVJIAZWMVZCECJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoro-1,2,3,4-tetrahydrophenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-1,2,3,4-tetrahydrophenazine?
The IUPAC name of 7-fluoro-1,2,3,4-tetrahydrophenazine (CID 2812780) is 7-fluoro-1,2,3,4-tetrahydrophenazine.
What is the SMILES notation for 7-fluoro-1,2,3,4-tetrahydrophenazine?
The canonical SMILES for 7-fluoro-1,2,3,4-tetrahydrophenazine is Fc1ccc2nc3c(nc2c1)CCCC3.
What is the InChIKey of 7-fluoro-1,2,3,4-tetrahydrophenazine?
The InChIKey is LVJIAZWMVZCECJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FN2/c13-8-5-6-11-12(7-8)15-10-4-2-1-3-9(10)14-11/h5-7H,1-4H2.
What are the key properties of 7-fluoro-1,2,3,4-tetrahydrophenazine?
7-fluoro-1,2,3,4-tetrahydrophenazine has a molecular weight of 202.23 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1,2,3,4-tetrahydrophenazine is sourced from PubChem (CID 2812780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).