About 3,5-dimethyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-sulfonamide
3,5-dimethyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-sulfonamide (PubChem CID 2813147) has the molecular formula C17H16N2O4S
and a molecular weight of 344.39 g/mol. Its IUPAC name is 3,5-dimethyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-sulfonamide.
Molecular Properties
| Compound Name | 3,5-dimethyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-sulfonamide |
| PubChem CID | 2813147 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3,5-dimethyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C17H16N2O4S/c1-12-17(13(2)23-18-12)24(20,21)19-15-10-6-7-11-16(15)22-14-8-4-3-5-9-14/h3-11,19H,1-2H3 |
| InChIKey | JTYFXKUXQBOWBU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,5-dimethyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-sulfonamide?
The IUPAC name of 3,5-dimethyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-sulfonamide (CID 2813147) is 3,5-dimethyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-sulfonamide.
What is the SMILES notation for 3,5-dimethyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-sulfonamide?
The canonical SMILES for 3,5-dimethyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-sulfonamide is Cc1noc(C)c1S(=O)(=O)Nc1ccccc1Oc1ccccc1.
What is the InChIKey of 3,5-dimethyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-sulfonamide?
The InChIKey is JTYFXKUXQBOWBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O4S/c1-12-17(13(2)23-18-12)24(20,21)19-15-10-6-7-11-16(15)22-14-8-4-3-5-9-14/h3-11,19H,1-2H3.
What are the key properties of 3,5-dimethyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-sulfonamide?
3,5-dimethyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-sulfonamide has a molecular weight of 344.39 g/mol, XLogP of 3.88, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-N-(2-phenoxyphenyl)-1,2-oxazole-4-sulfonamide is sourced from PubChem (CID 2813147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).