C14H16N2 — CID 2813212
6,7-dimethyl-1,2,3,4-tetrahydrophenazine (PubChem CID 2813212) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 6,7-dimethyl-1,2,3,4-tetrahydrophenazine.
| Compound Name | 6,7-dimethyl-1,2,3,4-tetrahydrophenazine |
|---|---|
| PubChem CID | 2813212 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 6,7-dimethyl-1,2,3,4-tetrahydrophenazine |
| SMILES | Cc1ccc2nc3c(nc2c1C)CCCC3 |
| InChI | InChI=1S/C14H16N2/c1-9-7-8-13-14(10(9)2)16-12-6-4-3-5-11(12)15-13/h7-8H,3-6H2,1-2H3 |
| InChIKey | YWZJYIYCHZLIKR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |