C14H18N2O4S — CID 2813228
2-[2-(2-morpholin-4-ylanilino)-2-oxoethyl]sulfanylacetic acid (PubChem CID 2813228) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-[2-(2-morpholin-4-ylanilino)-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-(2-morpholin-4-ylanilino)-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 2813228 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-[2-(2-morpholin-4-ylanilino)-2-oxoethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C14H18N2O4S/c17-13(9-21-10-14(18)19)15-11-3-1-2-4-12(11)16-5-7-20-8-6-16/h1-4H,5-10H2,(H,15,17)(H,18,19) |
| InChIKey | FWMJCWQEOCMQQA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |