About 1-(4-fluorophenyl)-N,5-dimethyl-N-(1-methylpiperidin-4-yl)pyrazole-4-carboxamide
1-(4-fluorophenyl)-N,5-dimethyl-N-(1-methylpiperidin-4-yl)pyrazole-4-carboxamide (PubChem CID 2813250) has the molecular formula C18H23FN4O
and a molecular weight of 330.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N,5-dimethyl-N-(1-methylpiperidin-4-yl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-N,5-dimethyl-N-(1-methylpiperidin-4-yl)pyrazole-4-carboxamide |
| PubChem CID | 2813250 |
| Molecular Formula | C18H23FN4O |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-(4-fluorophenyl)-N,5-dimethyl-N-(1-methylpiperidin-4-yl)pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N(C)C2CCN(C)CC2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H23FN4O/c1-13-17(12-20-23(13)16-6-4-14(19)5-7-16)18(24)22(3)15-8-10-21(2)11-9-15/h4-7,12,15H,8-11H2,1-3H3 |
| InChIKey | PAZLPZQZBMFLGW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-fluorophenyl)-N,5-dimethyl-N-(1-methylpiperidin-4-yl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-N,5-dimethyl-N-(1-methylpiperidin-4-yl)pyrazole-4-carboxamide?
The IUPAC name of 1-(4-fluorophenyl)-N,5-dimethyl-N-(1-methylpiperidin-4-yl)pyrazole-4-carboxamide (CID 2813250) is 1-(4-fluorophenyl)-N,5-dimethyl-N-(1-methylpiperidin-4-yl)pyrazole-4-carboxamide.
What is the SMILES notation for 1-(4-fluorophenyl)-N,5-dimethyl-N-(1-methylpiperidin-4-yl)pyrazole-4-carboxamide?
The canonical SMILES for 1-(4-fluorophenyl)-N,5-dimethyl-N-(1-methylpiperidin-4-yl)pyrazole-4-carboxamide is Cc1c(C(=O)N(C)C2CCN(C)CC2)cnn1-c1ccc(F)cc1.
What is the InChIKey of 1-(4-fluorophenyl)-N,5-dimethyl-N-(1-methylpiperidin-4-yl)pyrazole-4-carboxamide?
The InChIKey is PAZLPZQZBMFLGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23FN4O/c1-13-17(12-20-23(13)16-6-4-14(19)5-7-16)18(24)22(3)15-8-10-21(2)11-9-15/h4-7,12,15H,8-11H2,1-3H3.
What are the key properties of 1-(4-fluorophenyl)-N,5-dimethyl-N-(1-methylpiperidin-4-yl)pyrazole-4-carboxamide?
1-(4-fluorophenyl)-N,5-dimethyl-N-(1-methylpiperidin-4-yl)pyrazole-4-carboxamide has a molecular weight of 330.41 g/mol, XLogP of 2.49, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-N,5-dimethyl-N-(1-methylpiperidin-4-yl)pyrazole-4-carboxamide is sourced from PubChem (CID 2813250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).