C19H20N4O2 — CID 2813282
5-benzyl-11-tert-butyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione (PubChem CID 2813282) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 5-benzyl-11-tert-butyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione.
| Compound Name | 5-benzyl-11-tert-butyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione |
|---|---|
| PubChem CID | 2813282 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 5-benzyl-11-tert-butyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione |
| SMILES | CC(C)(C)c1cc2nc3c(c(=O)n2[nH]1)CN(Cc1ccccc1)C3=O |
| InChI | InChI=1S/C19H20N4O2/c1-19(2,3)14-9-15-20-16-13(17(24)23(15)21-14)11-22(18(16)25)10-12-7-5-4-6-8-12/h4-9,21H,10-11H2,1-3H3 |
| InChIKey | FEVIKHXUNPKMJB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |