C13H14N2 — CID 2813348
6-methyl-1,2,3,4-tetrahydrophenazine (PubChem CID 2813348) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 6-methyl-1,2,3,4-tetrahydrophenazine.
| Compound Name | 6-methyl-1,2,3,4-tetrahydrophenazine |
|---|---|
| PubChem CID | 2813348 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 6-methyl-1,2,3,4-tetrahydrophenazine |
| SMILES | Cc1cccc2nc3c(nc12)CCCC3 |
| InChI | InChI=1S/C13H14N2/c1-9-5-4-8-12-13(9)15-11-7-3-2-6-10(11)14-12/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | WIAPTWKGYKQWRB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |