C14H18N4O3S — CID 2813425
1-methyl-N-(2-morpholin-4-ylphenyl)imidazole-4-sulfonamide (PubChem CID 2813425) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is 1-methyl-N-(2-morpholin-4-ylphenyl)imidazole-4-sulfonamide.
| Compound Name | 1-methyl-N-(2-morpholin-4-ylphenyl)imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 2813425 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1-methyl-N-(2-morpholin-4-ylphenyl)imidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)Nc2ccccc2N2CCOCC2)c1 |
| InChI | InChI=1S/C14H18N4O3S/c1-17-10-14(15-11-17)22(19,20)16-12-4-2-3-5-13(12)18-6-8-21-9-7-18/h2-5,10-11,16H,6-9H2,1H3 |
| InChIKey | DTHKSDDOGBTWCW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |