About 4-cyano-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide
4-cyano-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide (PubChem CID 2813529) has the molecular formula C19H17N5O4S2
and a molecular weight of 443.51 g/mol. Its IUPAC name is 4-cyano-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-cyano-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide |
| PubChem CID | 2813529 |
| Molecular Formula | C19H17N5O4S2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 4-cyano-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(NS(=O)(=O)c3ccc(C#N)cc3)cc2)n1 |
| InChI | InChI=1S/C19H17N5O4S2/c1-13-11-14(2)22-19(21-13)24-30(27,28)18-9-5-16(6-10-18)23-29(25,26)17-7-3-15(12-20)4-8-17/h3-11,23H,1-2H3,(H,21,22,24) |
| InChIKey | IAQYZYGKIMQFIA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-cyano-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide?
The IUPAC name of 4-cyano-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide (CID 2813529) is 4-cyano-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide.
What is the SMILES notation for 4-cyano-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide?
The canonical SMILES for 4-cyano-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide is Cc1cc(C)nc(NS(=O)(=O)c2ccc(NS(=O)(=O)c3ccc(C#N)cc3)cc2)n1.
What is the InChIKey of 4-cyano-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide?
The InChIKey is IAQYZYGKIMQFIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5O4S2/c1-13-11-14(2)22-19(21-13)24-30(27,28)18-9-5-16(6-10-18)23-29(25,26)17-7-3-15(12-20)4-8-17/h3-11,23H,1-2H3,(H,21,22,24).
What are the key properties of 4-cyano-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide?
4-cyano-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide has a molecular weight of 443.51 g/mol, XLogP of 2.57, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]benzenesulfonamide is sourced from PubChem (CID 2813529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).