About 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea (PubChem CID 2813928) has the molecular formula C15H19N3O4S
and a molecular weight of 337.40 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea.
Molecular Properties
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea |
| PubChem CID | 2813928 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2cc(C(C)(C)C)on2)cc1 |
| InChI | InChI=1S/C15H19N3O4S/c1-10-5-7-11(8-6-10)23(20,21)18-14(19)16-13-9-12(22-17-13)15(2,3)4/h5-9H,1-4H3,(H2,16,17,18,19) |
| InChIKey | CVAYEIJCAKOCQY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea?
The IUPAC name of 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea (CID 2813928) is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea.
What is the SMILES notation for 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea?
The canonical SMILES for 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea is Cc1ccc(S(=O)(=O)NC(=O)Nc2cc(C(C)(C)C)on2)cc1.
What is the InChIKey of 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea?
The InChIKey is CVAYEIJCAKOCQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O4S/c1-10-5-7-11(8-6-10)23(20,21)18-14(19)16-13-9-12(22-17-13)15(2,3)4/h5-9H,1-4H3,(H2,16,17,18,19).
What are the key properties of 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea?
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea has a molecular weight of 337.40 g/mol, XLogP of 2.79, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea is sourced from PubChem (CID 2813928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).