About 3,5-dimethyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-sulfonamide
3,5-dimethyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-sulfonamide (PubChem CID 2814219) has the molecular formula C16H21N3O3S
and a molecular weight of 335.43 g/mol. Its IUPAC name is 3,5-dimethyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-sulfonamide.
Molecular Properties
| Compound Name | 3,5-dimethyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-sulfonamide |
| PubChem CID | 2814219 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 3,5-dimethyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C16H21N3O3S/c1-12-16(13(2)22-17-12)23(20,21)18-14-6-8-15(9-7-14)19-10-4-3-5-11-19/h6-9,18H,3-5,10-11H2,1-2H3 |
| InChIKey | ZWYBNASKOFXECF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-sulfonamide?
The IUPAC name of 3,5-dimethyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-sulfonamide (CID 2814219) is 3,5-dimethyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-sulfonamide.
What is the SMILES notation for 3,5-dimethyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-sulfonamide?
The canonical SMILES for 3,5-dimethyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-sulfonamide is Cc1noc(C)c1S(=O)(=O)Nc1ccc(N2CCCCC2)cc1.
What is the InChIKey of 3,5-dimethyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-sulfonamide?
The InChIKey is ZWYBNASKOFXECF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O3S/c1-12-16(13(2)22-17-12)23(20,21)18-14-6-8-15(9-7-14)19-10-4-3-5-11-19/h6-9,18H,3-5,10-11H2,1-2H3.
What are the key properties of 3,5-dimethyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-sulfonamide?
3,5-dimethyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-sulfonamide has a molecular weight of 335.43 g/mol, XLogP of 3.08, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-sulfonamide is sourced from PubChem (CID 2814219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).