About N-[4-[(3,5-dimethylphenyl)carbamoylamino]phenyl]acetamide
N-[4-[(3,5-dimethylphenyl)carbamoylamino]phenyl]acetamide (PubChem CID 2814306) has the molecular formula C17H19N3O2
and a molecular weight of 297.36 g/mol. Its IUPAC name is N-[4-[(3,5-dimethylphenyl)carbamoylamino]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(3,5-dimethylphenyl)carbamoylamino]phenyl]acetamide |
| PubChem CID | 2814306 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[4-[(3,5-dimethylphenyl)carbamoylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)Nc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C17H19N3O2/c1-11-8-12(2)10-16(9-11)20-17(22)19-15-6-4-14(5-7-15)18-13(3)21/h4-10H,1-3H3,(H,18,21)(H2,19,20,22) |
| InChIKey | RGDALDOPBMLMFO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[4-[(3,5-dimethylphenyl)carbamoylamino]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(3,5-dimethylphenyl)carbamoylamino]phenyl]acetamide?
The IUPAC name of N-[4-[(3,5-dimethylphenyl)carbamoylamino]phenyl]acetamide (CID 2814306) is N-[4-[(3,5-dimethylphenyl)carbamoylamino]phenyl]acetamide.
What is the SMILES notation for N-[4-[(3,5-dimethylphenyl)carbamoylamino]phenyl]acetamide?
The canonical SMILES for N-[4-[(3,5-dimethylphenyl)carbamoylamino]phenyl]acetamide is CC(=O)Nc1ccc(NC(=O)Nc2cc(C)cc(C)c2)cc1.
What is the InChIKey of N-[4-[(3,5-dimethylphenyl)carbamoylamino]phenyl]acetamide?
The InChIKey is RGDALDOPBMLMFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O2/c1-11-8-12(2)10-16(9-11)20-17(22)19-15-6-4-14(5-7-15)18-13(3)21/h4-10H,1-3H3,(H,18,21)(H2,19,20,22).
What are the key properties of N-[4-[(3,5-dimethylphenyl)carbamoylamino]phenyl]acetamide?
N-[4-[(3,5-dimethylphenyl)carbamoylamino]phenyl]acetamide has a molecular weight of 297.36 g/mol, XLogP of 3.91, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(3,5-dimethylphenyl)carbamoylamino]phenyl]acetamide is sourced from PubChem (CID 2814306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).