About 1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(9H-fluoren-9-yl)piperazine
1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(9H-fluoren-9-yl)piperazine (PubChem CID 2814415) has the molecular formula C22H24N4O2S
and a molecular weight of 408.53 g/mol. Its IUPAC name is 1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(9H-fluoren-9-yl)piperazine.
Molecular Properties
| Compound Name | 1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(9H-fluoren-9-yl)piperazine |
| PubChem CID | 2814415 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(9H-fluoren-9-yl)piperazine |
| SMILES | Cc1nc(S(=O)(=O)N2CCN(C3c4ccccc4-c4ccccc43)CC2)cn1C |
| InChI | InChI=1S/C22H24N4O2S/c1-16-23-21(15-24(16)2)29(27,28)26-13-11-25(12-14-26)22-19-9-5-3-7-17(19)18-8-4-6-10-20(18)22/h3-10,15,22H,11-14H2,1-2H3 |
| InChIKey | MLUMXKRBSGKSFW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(9H-fluoren-9-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(9H-fluoren-9-yl)piperazine?
The IUPAC name of 1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(9H-fluoren-9-yl)piperazine (CID 2814415) is 1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(9H-fluoren-9-yl)piperazine.
What is the SMILES notation for 1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(9H-fluoren-9-yl)piperazine?
The canonical SMILES for 1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(9H-fluoren-9-yl)piperazine is Cc1nc(S(=O)(=O)N2CCN(C3c4ccccc4-c4ccccc43)CC2)cn1C.
What is the InChIKey of 1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(9H-fluoren-9-yl)piperazine?
The InChIKey is MLUMXKRBSGKSFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N4O2S/c1-16-23-21(15-24(16)2)29(27,28)26-13-11-25(12-14-26)22-19-9-5-3-7-17(19)18-8-4-6-10-20(18)22/h3-10,15,22H,11-14H2,1-2H3.
What are the key properties of 1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(9H-fluoren-9-yl)piperazine?
1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(9H-fluoren-9-yl)piperazine has a molecular weight of 408.53 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(9H-fluoren-9-yl)piperazine is sourced from PubChem (CID 2814415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).