About methyl 3-[[2-[1-[(3,5-dimethylphenyl)carbamoyl]-3-oxopiperazin-2-yl]acetyl]amino]benzoate
methyl 3-[[2-[1-[(3,5-dimethylphenyl)carbamoyl]-3-oxopiperazin-2-yl]acetyl]amino]benzoate (PubChem CID 2814472) has the molecular formula C23H26N4O5
and a molecular weight of 438.48 g/mol. Its IUPAC name is methyl 3-[[2-[1-[(3,5-dimethylphenyl)carbamoyl]-3-oxopiperazin-2-yl]acetyl]amino]benzoate.
Molecular Properties
| Compound Name | methyl 3-[[2-[1-[(3,5-dimethylphenyl)carbamoyl]-3-oxopiperazin-2-yl]acetyl]amino]benzoate |
| PubChem CID | 2814472 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | methyl 3-[[2-[1-[(3,5-dimethylphenyl)carbamoyl]-3-oxopiperazin-2-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CC2C(=O)NCCN2C(=O)Nc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C23H26N4O5/c1-14-9-15(2)11-18(10-14)26-23(31)27-8-7-24-21(29)19(27)13-20(28)25-17-6-4-5-16(12-17)22(30)32-3/h4-6,9-12,19H,7-8,13H2,1-3H3,(H,24,29)(H,25,28)(H,26,31) |
| InChIKey | PNMVCUUPQYUMNJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[[2-[1-[(3,5-dimethylphenyl)carbamoyl]-3-oxopiperazin-2-yl]acetyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[2-[1-[(3,5-dimethylphenyl)carbamoyl]-3-oxopiperazin-2-yl]acetyl]amino]benzoate?
The IUPAC name of methyl 3-[[2-[1-[(3,5-dimethylphenyl)carbamoyl]-3-oxopiperazin-2-yl]acetyl]amino]benzoate (CID 2814472) is methyl 3-[[2-[1-[(3,5-dimethylphenyl)carbamoyl]-3-oxopiperazin-2-yl]acetyl]amino]benzoate.
What is the SMILES notation for methyl 3-[[2-[1-[(3,5-dimethylphenyl)carbamoyl]-3-oxopiperazin-2-yl]acetyl]amino]benzoate?
The canonical SMILES for methyl 3-[[2-[1-[(3,5-dimethylphenyl)carbamoyl]-3-oxopiperazin-2-yl]acetyl]amino]benzoate is COC(=O)c1cccc(NC(=O)CC2C(=O)NCCN2C(=O)Nc2cc(C)cc(C)c2)c1.
What is the InChIKey of methyl 3-[[2-[1-[(3,5-dimethylphenyl)carbamoyl]-3-oxopiperazin-2-yl]acetyl]amino]benzoate?
The InChIKey is PNMVCUUPQYUMNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N4O5/c1-14-9-15(2)11-18(10-14)26-23(31)27-8-7-24-21(29)19(27)13-20(28)25-17-6-4-5-16(12-17)22(30)32-3/h4-6,9-12,19H,7-8,13H2,1-3H3,(H,24,29)(H,25,28)(H,26,31).
What are the key properties of methyl 3-[[2-[1-[(3,5-dimethylphenyl)carbamoyl]-3-oxopiperazin-2-yl]acetyl]amino]benzoate?
methyl 3-[[2-[1-[(3,5-dimethylphenyl)carbamoyl]-3-oxopiperazin-2-yl]acetyl]amino]benzoate has a molecular weight of 438.48 g/mol, XLogP of 2.45, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[2-[1-[(3,5-dimethylphenyl)carbamoyl]-3-oxopiperazin-2-yl]acetyl]amino]benzoate is sourced from PubChem (CID 2814472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).