C15H12N4O3S — CID 2814525
N-(4-sulfamoylphenyl)quinoxaline-6-carboxamide (PubChem CID 2814525) has the molecular formula C15H12N4O3S and a molecular weight of 328.35 g/mol. Its IUPAC name is N-(4-sulfamoylphenyl)quinoxaline-6-carboxamide.
| Compound Name | N-(4-sulfamoylphenyl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 2814525 |
| Molecular Formula | C15H12N4O3S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | N-(4-sulfamoylphenyl)quinoxaline-6-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2ccc3nccnc3c2)cc1 |
| InChI | InChI=1S/C15H12N4O3S/c16-23(21,22)12-4-2-11(3-5-12)19-15(20)10-1-6-13-14(9-10)18-8-7-17-13/h1-9H,(H,19,20)(H2,16,21,22) |
| InChIKey | AWXFBAFTDPYROB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |