C21H16N8S — CID 2814599
1-phenyl-4-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]pyrazolo[5,4-d]pyrimidine (PubChem CID 2814599) has the molecular formula C21H16N8S and a molecular weight of 412.48 g/mol. Its IUPAC name is 1-phenyl-4-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]pyrazolo[5,4-d]pyrimidine.
| Compound Name | 1-phenyl-4-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]pyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 2814599 |
| Molecular Formula | C21H16N8S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 1-phenyl-4-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]pyrazolo[5,4-d]pyrimidine |
| SMILES | C=CCn1c(Sc2ncnc3c2cnn3-c2ccccc2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C21H16N8S/c1-2-12-28-18(15-8-10-22-11-9-15)26-27-21(28)30-20-17-13-25-29(19(17)23-14-24-20)16-6-4-3-5-7-16/h2-11,13-14H,1,12H2 |
| InChIKey | DOQWWJMYAVEMDQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|