C21H19N5S2 — CID 2814611
4-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (PubChem CID 2814611) has the molecular formula C21H19N5S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is 4-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine.
| Compound Name | 4-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 2814611 |
| Molecular Formula | C21H19N5S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 4-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| SMILES | C=CCn1c(Sc2ncnc3sc4c(c23)CCCC4)nnc1-c1ccccc1 |
| InChI | InChI=1S/C21H19N5S2/c1-2-12-26-18(14-8-4-3-5-9-14)24-25-21(26)28-20-17-15-10-6-7-11-16(15)27-19(17)22-13-23-20/h2-5,8-9,13H,1,6-7,10-12H2 |
| InChIKey | PQAQQYGOSAGJRR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|