About N,5-dimethyl-3-phenyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-4-carboxamide
N,5-dimethyl-3-phenyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-4-carboxamide (PubChem CID 2814675) has the molecular formula C19H19N3O2
and a molecular weight of 321.38 g/mol. Its IUPAC name is N,5-dimethyl-3-phenyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N,5-dimethyl-3-phenyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-4-carboxamide |
| PubChem CID | 2814675 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N,5-dimethyl-3-phenyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)N(C)CCc1ccccn1 |
| InChI | InChI=1S/C19H19N3O2/c1-14-17(18(21-24-14)15-8-4-3-5-9-15)19(23)22(2)13-11-16-10-6-7-12-20-16/h3-10,12H,11,13H2,1-2H3 |
| InChIKey | ABZDSWDSXMFCBS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,5-dimethyl-3-phenyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-dimethyl-3-phenyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-4-carboxamide?
The IUPAC name of N,5-dimethyl-3-phenyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-4-carboxamide (CID 2814675) is N,5-dimethyl-3-phenyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-4-carboxamide.
What is the SMILES notation for N,5-dimethyl-3-phenyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-4-carboxamide?
The canonical SMILES for N,5-dimethyl-3-phenyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-4-carboxamide is Cc1onc(-c2ccccc2)c1C(=O)N(C)CCc1ccccn1.
What is the InChIKey of N,5-dimethyl-3-phenyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-4-carboxamide?
The InChIKey is ABZDSWDSXMFCBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O2/c1-14-17(18(21-24-14)15-8-4-3-5-9-15)19(23)22(2)13-11-16-10-6-7-12-20-16/h3-10,12H,11,13H2,1-2H3.
What are the key properties of N,5-dimethyl-3-phenyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-4-carboxamide?
N,5-dimethyl-3-phenyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-4-carboxamide has a molecular weight of 321.38 g/mol, XLogP of 3.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-dimethyl-3-phenyl-N-(2-pyridin-2-ylethyl)-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 2814675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).