C24H14ClNO4 — CID 2814730
3-benzoyl-4-(4-chlorophenyl)spiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione (PubChem CID 2814730) has the molecular formula C24H14ClNO4 and a molecular weight of 415.83 g/mol. Its IUPAC name is 3-benzoyl-4-(4-chlorophenyl)spiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione.
| Compound Name | 3-benzoyl-4-(4-chlorophenyl)spiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 2814730 |
| Molecular Formula | C24H14ClNO4 |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 3-benzoyl-4-(4-chlorophenyl)spiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione |
| SMILES | O=C(C1=NOC2(C(=O)c3ccccc3C2=O)C1c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H14ClNO4/c25-16-12-10-14(11-13-16)19-20(21(27)15-6-2-1-3-7-15)26-30-24(19)22(28)17-8-4-5-9-18(17)23(24)29/h1-13,19H |
| InChIKey | VWAFQUQWCWADPQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|