About 5-[[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]amino]-5-oxopentanoic acid
5-[[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]amino]-5-oxopentanoic acid (PubChem CID 2814842) has the molecular formula C20H22N2O4
and a molecular weight of 354.41 g/mol. Its IUPAC name is 5-[[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]amino]-5-oxopentanoic acid.
Molecular Properties
| Compound Name | 5-[[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]amino]-5-oxopentanoic acid |
| PubChem CID | 2814842 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 5-[[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]amino]-5-oxopentanoic acid |
| SMILES | Cc1ccc(Oc2ncccc2NC(=O)CCCC(=O)O)c2c1CCC2 |
| InChI | InChI=1S/C20H22N2O4/c1-13-10-11-17(15-6-2-5-14(13)15)26-20-16(7-4-12-21-20)22-18(23)8-3-9-19(24)25/h4,7,10-12H,2-3,5-6,8-9H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | AIBHAPAFWTXDCG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]amino]-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]amino]-5-oxopentanoic acid?
The IUPAC name of 5-[[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]amino]-5-oxopentanoic acid (CID 2814842) is 5-[[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]amino]-5-oxopentanoic acid.
What is the SMILES notation for 5-[[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]amino]-5-oxopentanoic acid?
The canonical SMILES for 5-[[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]amino]-5-oxopentanoic acid is Cc1ccc(Oc2ncccc2NC(=O)CCCC(=O)O)c2c1CCC2.
What is the InChIKey of 5-[[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]amino]-5-oxopentanoic acid?
The InChIKey is AIBHAPAFWTXDCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O4/c1-13-10-11-17(15-6-2-5-14(13)15)26-20-16(7-4-12-21-20)22-18(23)8-3-9-19(24)25/h4,7,10-12H,2-3,5-6,8-9H2,1H3,(H,22,23)(H,24,25).
What are the key properties of 5-[[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]amino]-5-oxopentanoic acid?
5-[[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]amino]-5-oxopentanoic acid has a molecular weight of 354.41 g/mol, XLogP of 3.86, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-pyridinyl]amino]-5-oxopentanoic acid is sourced from PubChem (CID 2814842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).