About 9-[2-(2,6-dimethylmorpholin-4-yl)ethyl]purin-6-amine
9-[2-(2,6-dimethylmorpholin-4-yl)ethyl]purin-6-amine (PubChem CID 2814988) has the molecular formula C13H20N6O
and a molecular weight of 276.34 g/mol. Its IUPAC name is 9-[2-(2,6-dimethylmorpholin-4-yl)ethyl]purin-6-amine.
Molecular Properties
| Compound Name | 9-[2-(2,6-dimethylmorpholin-4-yl)ethyl]purin-6-amine |
| PubChem CID | 2814988 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 9-[2-(2,6-dimethylmorpholin-4-yl)ethyl]purin-6-amine |
| SMILES | CC1CN(CCn2cnc3c(N)ncnc32)CC(C)O1 |
| InChI | InChI=1S/C13H20N6O/c1-9-5-18(6-10(2)20-9)3-4-19-8-17-11-12(14)15-7-16-13(11)19/h7-10H,3-6H2,1-2H3,(H2,14,15,16) |
| InChIKey | GKVDMQKSEFKMGT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 9-[2-(2,6-dimethylmorpholin-4-yl)ethyl]purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[2-(2,6-dimethylmorpholin-4-yl)ethyl]purin-6-amine?
The IUPAC name of 9-[2-(2,6-dimethylmorpholin-4-yl)ethyl]purin-6-amine (CID 2814988) is 9-[2-(2,6-dimethylmorpholin-4-yl)ethyl]purin-6-amine.
What is the SMILES notation for 9-[2-(2,6-dimethylmorpholin-4-yl)ethyl]purin-6-amine?
The canonical SMILES for 9-[2-(2,6-dimethylmorpholin-4-yl)ethyl]purin-6-amine is CC1CN(CCn2cnc3c(N)ncnc32)CC(C)O1.
What is the InChIKey of 9-[2-(2,6-dimethylmorpholin-4-yl)ethyl]purin-6-amine?
The InChIKey is GKVDMQKSEFKMGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N6O/c1-9-5-18(6-10(2)20-9)3-4-19-8-17-11-12(14)15-7-16-13(11)19/h7-10H,3-6H2,1-2H3,(H2,14,15,16).
What are the key properties of 9-[2-(2,6-dimethylmorpholin-4-yl)ethyl]purin-6-amine?
9-[2-(2,6-dimethylmorpholin-4-yl)ethyl]purin-6-amine has a molecular weight of 276.34 g/mol, XLogP of 0.52, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[2-(2,6-dimethylmorpholin-4-yl)ethyl]purin-6-amine is sourced from PubChem (CID 2814988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).