C24H26N4O4 — CID 2815004
7-[2,3-bis(phenylmethoxy)propyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 2815004) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 7-[2,3-bis(phenylmethoxy)propyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[2,3-bis(phenylmethoxy)propyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 2815004 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 7-[2,3-bis(phenylmethoxy)propyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CC(COCc2ccccc2)OCc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C24H26N4O4/c1-26-22-21(23(29)27(2)24(26)30)28(17-25-22)13-20(32-15-19-11-7-4-8-12-19)16-31-14-18-9-5-3-6-10-18/h3-12,17,20H,13-16H2,1-2H3 |
| InChIKey | QISOOLBEBNJJEV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |