C14H15N5O2S — CID 2815019
8-(2-aminophenyl)sulfanyl-1,3,7-trimethylpurine-2,6-dione (PubChem CID 2815019) has the molecular formula C14H15N5O2S and a molecular weight of 317.37 g/mol. Its IUPAC name is 8-(2-aminophenyl)sulfanyl-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-(2-aminophenyl)sulfanyl-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 2815019 |
| Molecular Formula | C14H15N5O2S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 8-(2-aminophenyl)sulfanyl-1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(Sc3ccccc3N)n2C)n(C)c1=O |
| InChI | InChI=1S/C14H15N5O2S/c1-17-10-11(18(2)14(21)19(3)12(10)20)16-13(17)22-9-7-5-4-6-8(9)15/h4-7H,15H2,1-3H3 |
| InChIKey | WYFHNJFVSDEZBE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|