C17H17N7OS2 — CID 2815107
1-[[2-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-3-phenylthiourea (PubChem CID 2815107) has the molecular formula C17H17N7OS2 and a molecular weight of 399.51 g/mol. Its IUPAC name is 1-[[2-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[2-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 2815107 |
| Molecular Formula | C17H17N7OS2 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 1-[[2-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-3-phenylthiourea |
| SMILES | Cn1c(SCC(=O)NNC(=S)Nc2ccccc2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C17H17N7OS2/c1-24-15(12-7-9-18-10-8-12)21-23-17(24)27-11-14(25)20-22-16(26)19-13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H,20,25)(H2,19,22,26) |
| InChIKey | JBLMFKKPWLHTCD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|