C14H13N7 — CID 2815126
N-(pyridin-3-ylmethylideneamino)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 2815126) has the molecular formula C14H13N7 and a molecular weight of 279.31 g/mol. Its IUPAC name is N-(pyridin-3-ylmethylideneamino)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | N-(pyridin-3-ylmethylideneamino)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 2815126 |
| Molecular Formula | C14H13N7 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-(pyridin-3-ylmethylideneamino)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | C(=NNc1c2c(nc3ncnn13)CCC2)c1cccnc1 |
| InChI | InChI=1S/C14H13N7/c1-4-11-12(5-1)19-14-16-9-18-21(14)13(11)20-17-8-10-3-2-6-15-7-10/h2-3,6-9,20H,1,4-5H2 |
| InChIKey | JQYYHDZIYIPTDM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|